CAS 121209-88-9 is the registry number for (±)-Dihydroguaiaretic Acid. Offered by: TRC. Available pack sizes: 25mg.
4-[(2S,3S)-4-(4-hydroxy-3-methoxyphenyl)-2,3-dimethylbutyl]-2-methoxyphenol (CAS 121209-88-9) is a chemical compound with the molecular formula C20H26O4 and a molecular weight of 330.4 g/mol. IUPAC name: 4-[(2S,3S)-4-(4-hydroxy-3-methoxyphenyl)-2,3-dimethylbutyl]-2-methoxyphenol. InChIKey: ADFOLUXMYYCTRR-KBPBESRZSA-N.
| Molecular formula | C20H26O4 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 4-[(2S,3S)-4-(4-hydroxy-3-methoxyphenyl)-2,3-dimethylbutyl]-2-methoxyphenol |
| InChIKey | ADFOLUXMYYCTRR-KBPBESRZSA-N |
| SMILES | C[C@@H](CC1=CC(=C(C=C1)O)OC)[C@@H](C)CC2=CC(=C(C=C2)O)OC |
Computed by PubChem (NCBI)