CAS 31932-13-5 appears in our catalog under these names: Cannabidivarinic Acid, Cannabidivarinic Acid, Cannabidivarinic acid (CBDVA) 100 µg/mL in Acetonitrile, Cannabidivarinic acid (CBDVA) 1000 µg/mL in Acetonitrile, Cannabidivarinic acid, 99.67%. Offered by: GLPBio, Chemat Brand, Dr. Ehrenstorfer, Biosynth, MedChemExpress. Available pack sizes: 5mg, on request, 1ml, 1mg, 5 mg, 1 mg, 1x1ml.
2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-6-propylbenzoic acid (CAS 31932-13-5) is a chemical compound with the molecular formula C20H26O4 and a molecular weight of 330.4 g/mol. IUPAC name: 2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-6-propylbenzoic acid. InChIKey: CZXWOKHVLNYAHI-LSDHHAIUSA-N.
| Molecular formula | C20H26O4 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-6-propylbenzoic acid |
| InChIKey | CZXWOKHVLNYAHI-LSDHHAIUSA-N |
| SMILES | CCCC1=CC(=C(C(=C1C(=O)O)O)[C@@H]2C=C(CC[C@H]2C(=C)C)C)O |
Computed by PubChem (NCBI)