Products 66185-70-4
CAS 66185-70-4 appears in our catalog under these names: 4-Methylumbelliferyl decanoate, 4-Methylumbelliferyl decanoate, 95%, 4-Methylumbelliferyl Decanoate, 97%, 4-Methylumbelliferyl Decanoate, >95% (HPLC), 4-Methylumbelliferyl decanoate, 500 mg. Offered by: Biosynth, MedChemExpress, Combi-blocks, AmBeed, TRC. Available pack sizes: 1g, 0,5g, 2g, 5g, 500 mg, 100 mg, 1 g, 250mg.
(4-methyl-2-oxochromen-7-yl) decanoate (CAS 66185-70-4) is a chemical compound with the molecular formula C20H26O4 and a molecular weight of 330.4 g/mol. IUPAC name: (4-methyl-2-oxochromen-7-yl) decanoate. InChIKey: HTFJJKMPGKQQNM-UHFFFAOYSA-N.
| Molecular formula | C20H26O4 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | (4-methyl-2-oxochromen-7-yl) decanoate |
| InChIKey | HTFJJKMPGKQQNM-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC1=CC2=C(C=C1)C(=CC(=O)O2)C |
Computed by PubChem (NCBI)
Synonyms:
4-Methylumbelliferyl Decanoate, (4-methyl-2-oxochromen-7-yl) decanoate, 4-Methyl-2-oxo-2H-chromen-7-yl decanoate, Decanoic Acid 4-Methyl-2-oxo-2H-1-benzopyran-7-yl Ester, (4-methyl-2-oxo-chromen-7-yl) Decanoate, Decanoic acid, 4-methyl-2-oxo-2H-1-benzopyran-7-yl ester, 4-Methyl-2-oxo-2H-1-benzopyran-7-yl decanoate