CAS 121210-26-2 is the registry number for Methyl (2S)-2-(4-hydroxyphenoxy)propanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl (2S)-2-(4-hydroxyphenoxy)propanoate (CAS 121210-26-2) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl (2S)-2-(4-hydroxyphenoxy)propanoate. InChIKey: UUYSCNGPNOYZMC-ZETCQYMHSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl (2S)-2-(4-hydroxyphenoxy)propanoate |
| InChIKey | UUYSCNGPNOYZMC-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)OC)OC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)