Products 1212127-10-0
CAS 1212127-10-0 appears in our catalog under these names: Cis-2-tert-butoxycarbonylamino-2-methyl-cyclopentanecarboxylic acid, 95%, Boc-NH-cis-2-Me-cyclopentane-COOH. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 5g, 250mg, 1g, 100mg.
Cis-(1S,2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 1212127-10-0) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: cis-(1S,2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: GKDUYHIMOWUHAF-PRHODGIISA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | cis-(1S,2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | GKDUYHIMOWUHAF-PRHODGIISA-N |
| SMILES | C[C@]1(CCC[C@@H]1C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)