Products 1212312-64-5
CAS 1212312-64-5 is the registry number for endo-3-(Fmoc-amino)bicyclo[2.2.1]heptane-2-carboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1S,2R,3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1212312-64-5) is a chemical compound with the molecular formula C23H23NO4 and a molecular weight of 377.4 g/mol. IUPAC name: (1S,2R,3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: RAQPAPMBITVVOX-OCYQJKLISA-N.
| Molecular formula | C23H23NO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (1S,2R,3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | RAQPAPMBITVVOX-OCYQJKLISA-N |
| SMILES | C1C[C@@H]2C[C@H]1[C@H]([C@@H]2NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)