Products 1212370-86-9

CAS 1212370-86-9 appears in our catalog under these names: (2S)-2-(2-Fluorobenzenesulfonamido)-3-phenylpropanoic acid, 95%, (2S)-2-(2-Fluorobenzenesulfonamido)-3-phenylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

(2S)-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid (CAS 1212370-86-9) is a chemical compound with the molecular formula C15H14FNO4S and a molecular weight of 323.3 g/mol. IUPAC name: (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid. InChIKey: KTMGPIGNLAPLER-ZDUSSCGKSA-N.

Identity
Molecular formulaC15H14FNO4S
Molecular weight323.3 g/mol
IUPAC name(2S)-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid
InChIKeyKTMGPIGNLAPLER-ZDUSSCGKSA-N
SMILESC1=CC=C(C=C1)C[C@@H](C(=O)O)NS(=O)(=O)C2=CC=CC=C2F

Computed by PubChem (NCBI)