CAS 40279-96-7 appears in our catalog under these names: 2-(4-Fluorophenylsulfonamido)-3-phenylpropanoic acid, 95+%, 2-{[(4-Fluorophenyl)sulfonyl]amino}-3-phenylpropanoic acid. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 500mg, 1g.
2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid (CAS 40279-96-7) is a chemical compound with the molecular formula C15H14FNO4S and a molecular weight of 323.3 g/mol. IUPAC name: 2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid. InChIKey: JRSXZZNEKZTTJP-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO4S |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid |
| InChIKey | JRSXZZNEKZTTJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NS(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)