CAS 333456-97-6 is the registry number for N-(4-Fluorophenyl)-n-[(4-methylphenyl)sulfonyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetic acid (CAS 333456-97-6) is a chemical compound with the molecular formula C15H14FNO4S and a molecular weight of 323.3 g/mol. IUPAC name: 2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetic acid. InChIKey: AJIDBRPPICAPET-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO4S |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetic acid |
| InChIKey | AJIDBRPPICAPET-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)