CAS 1212402-79-3 is the registry number for (2,4-Dimethylthiazole-5-carbonyl)-L-alanine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]propanoic acid (CAS 1212402-79-3) is a chemical compound with the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. IUPAC name: (2S)-2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]propanoic acid. InChIKey: IUUZKNAYJKZQTA-YFKPBYRVSA-N.
| Molecular formula | C9H12N2O3S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | (2S)-2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]propanoic acid |
| InChIKey | IUUZKNAYJKZQTA-YFKPBYRVSA-N |
| SMILES | CC1=C(SC(=N1)C)C(=O)N[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)