CAS 1212453-90-1 is the registry number for (1S)-2-Azabicyclo(2.2.1)heptane-4-carboxylic acid hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(1S)-2-azabicyclo[2.2.1]heptane-4-carboxylic acid;hydrochloride (CAS 1212453-90-1) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: (1S)-2-azabicyclo[2.2.1]heptane-4-carboxylic acid;hydrochloride. InChIKey: XWVAMMMWNZVEAH-SXWDIKBWSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | (1S)-2-azabicyclo[2.2.1]heptane-4-carboxylic acid;hydrochloride |
| InChIKey | XWVAMMMWNZVEAH-SXWDIKBWSA-N |
| SMILES | C1CC2(C[C@H]1NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)