CAS 1212843-46-3 is the registry number for 4–((1S)–1–Aminoethyl)benzene–1–sulfonamide. Offered by: GLPBio. Available pack sizes: 100mg.
4-[(1S)-1-aminoethyl]benzenesulfonamide (CAS 1212843-46-3) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: 4-[(1S)-1-aminoethyl]benzenesulfonamide. InChIKey: YIGSCEUQIQKFPL-LURJTMIESA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 4-[(1S)-1-aminoethyl]benzenesulfonamide |
| InChIKey | YIGSCEUQIQKFPL-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)S(=O)(=O)N)N |
Computed by PubChem (NCBI)