Products 1212878-04-0
CAS 1212878-04-0 is the registry number for (S)-2-Amino-2-(5-bromo-2-fluorophenyl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-2-(5-bromo-2-fluorophenyl)acetic acid (CAS 1212878-04-0) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: (2S)-2-amino-2-(5-bromo-2-fluorophenyl)acetic acid. InChIKey: LVTNZYPYXDVQNG-ZETCQYMHSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | (2S)-2-amino-2-(5-bromo-2-fluorophenyl)acetic acid |
| InChIKey | LVTNZYPYXDVQNG-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C=C1Br)[C@@H](C(=O)O)N)F |
Computed by PubChem (NCBI)