CAS 1212982-86-9 is the registry number for (S)-1-(2,2-difluorobenzo[d][1,3]dioxol-5-yl)-2-methylpropan-1-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpropan-1-amine (CAS 1212982-86-9) is a chemical compound with the molecular formula C11H13F2NO2 and a molecular weight of 229.22 g/mol. IUPAC name: (1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpropan-1-amine. InChIKey: ZACCKEUVRZDSSR-JTQLQIEISA-N.
| Molecular formula | C11H13F2NO2 |
|---|---|
| Molecular weight | 229.22 g/mol |
| IUPAC name | (1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpropan-1-amine |
| InChIKey | ZACCKEUVRZDSSR-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=CC2=C(C=C1)OC(O2)(F)F)N |
Computed by PubChem (NCBI)