CAS 1212983-95-3 is the registry number for (R)–2–((tert–Butoxycarbonyl)amino)–3–(3,5–dichlorophenyl)propanoic acid. Offered by: GLPBio. Available pack sizes: 100mg.
(2R)-3-(3,5-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1212983-95-3) is a chemical compound with the molecular formula C14H17Cl2NO4 and a molecular weight of 334.2 g/mol. IUPAC name: (2R)-3-(3,5-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VKAOZRGFKAVEKA-LLVKDONJSA-N.
| Molecular formula | C14H17Cl2NO4 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | (2R)-3-(3,5-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VKAOZRGFKAVEKA-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC(=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)