Products 1213089-19-0
CAS 1213089-19-0 is the registry number for (S)-1-(3-Bromo-5-(trifluoromethyl)phenyl)ethan-1-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-[3-bromo-5-(trifluoromethyl)phenyl]ethanamine (CAS 1213089-19-0) is a chemical compound with the molecular formula C9H9BrF3N and a molecular weight of 268.07 g/mol. IUPAC name: (1S)-1-[3-bromo-5-(trifluoromethyl)phenyl]ethanamine. InChIKey: YIVILYMTTFMOTL-YFKPBYRVSA-N.
| Molecular formula | C9H9BrF3N |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | (1S)-1-[3-bromo-5-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | YIVILYMTTFMOTL-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=CC(=CC(=C1)Br)C(F)(F)F)N |
Computed by PubChem (NCBI)