Products 1213150-66-3
CAS 1213150-66-3 is the registry number for (R)-1-(2,2-difluorobenzo[d][1,3]dioxol-4-yl)prop-2-en-1-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine (CAS 1213150-66-3) is a chemical compound with the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. IUPAC name: (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine. InChIKey: HOYYTSLDJYYJQZ-SSDOTTSWSA-N.
| Molecular formula | C10H9F2NO2 |
|---|---|
| Molecular weight | 213.18 g/mol |
| IUPAC name | (1R)-1-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-en-1-amine |
| InChIKey | HOYYTSLDJYYJQZ-SSDOTTSWSA-N |
| SMILES | C=C[C@H](C1=C2C(=CC=C1)OC(O2)(F)F)N |
Computed by PubChem (NCBI)