CAS 1213361-86-4 is the registry number for (S)-2-Amino-2-(2-fluoro-3-(trifluoromethyl)phenyl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-2-[2-fluoro-3-(trifluoromethyl)phenyl]acetic acid (CAS 1213361-86-4) is a chemical compound with the molecular formula C9H7F4NO2 and a molecular weight of 237.15 g/mol. IUPAC name: (2S)-2-amino-2-[2-fluoro-3-(trifluoromethyl)phenyl]acetic acid. InChIKey: GTKIJBKEZHNBGX-ZETCQYMHSA-N.
| Molecular formula | C9H7F4NO2 |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | (2S)-2-amino-2-[2-fluoro-3-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | GTKIJBKEZHNBGX-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)