Products 200876-83-1
CAS 200876-83-1 is the registry number for 2,2,2-Trifluoroethyl 2-fluorophenylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,2,2-trifluoroethyl N-(2-fluorophenyl)carbamate (CAS 200876-83-1) is a chemical compound with the molecular formula C9H7F4NO2 and a molecular weight of 237.15 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(2-fluorophenyl)carbamate. InChIKey: SJGCLODTAXBKGC-UHFFFAOYSA-N.
| Molecular formula | C9H7F4NO2 |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(2-fluorophenyl)carbamate |
| InChIKey | SJGCLODTAXBKGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)OCC(F)(F)F)F |
Computed by PubChem (NCBI)