Products 1806965-42-3
CAS 1806965-42-3 is the registry number for Methyl 5-amino-4-fluoro-2-(trifluoromethyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-amino-4-fluoro-2-(trifluoromethyl)benzoate (CAS 1806965-42-3) is a chemical compound with the molecular formula C9H7F4NO2 and a molecular weight of 237.15 g/mol. IUPAC name: methyl 5-amino-4-fluoro-2-(trifluoromethyl)benzoate. InChIKey: BBXJWANESBVRKF-UHFFFAOYSA-N.
| Molecular formula | C9H7F4NO2 |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | methyl 5-amino-4-fluoro-2-(trifluoromethyl)benzoate |
| InChIKey | BBXJWANESBVRKF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1C(F)(F)F)F)N |
Computed by PubChem (NCBI)