CAS 1213368-75-2 is the registry number for (S)-1-(4-Bromo-3-methylphenyl)-2-methylpropan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(4-bromo-3-methylphenyl)-2-methylpropan-1-amine (CAS 1213368-75-2) is a chemical compound with the molecular formula C11H16BrN and a molecular weight of 242.16 g/mol. IUPAC name: (1S)-1-(4-bromo-3-methylphenyl)-2-methylpropan-1-amine. InChIKey: PNJRMKCNPZGHJQ-NSHDSACASA-N.
| Molecular formula | C11H16BrN |
|---|---|
| Molecular weight | 242.16 g/mol |
| IUPAC name | (1S)-1-(4-bromo-3-methylphenyl)-2-methylpropan-1-amine |
| InChIKey | PNJRMKCNPZGHJQ-NSHDSACASA-N |
| SMILES | CC1=C(C=CC(=C1)[C@H](C(C)C)N)Br |
Computed by PubChem (NCBI)