Products 1888834-58-9
CAS 1888834-58-9 is the registry number for 2-(4-Bromophenyl)-n,n-dimethylpropan-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(4-bromophenyl)-N,N-dimethylpropan-1-amine (CAS 1888834-58-9) is a chemical compound with the molecular formula C11H16BrN and a molecular weight of 242.16 g/mol. IUPAC name: 2-(4-bromophenyl)-N,N-dimethylpropan-1-amine. InChIKey: XQSVLEPCIIKDAC-UHFFFAOYSA-N.
| Molecular formula | C11H16BrN |
|---|---|
| Molecular weight | 242.16 g/mol |
| IUPAC name | 2-(4-bromophenyl)-N,N-dimethylpropan-1-amine |
| InChIKey | XQSVLEPCIIKDAC-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)