CAS 1864672-05-8 is the registry number for [(4-Bromo-3-methylphenyl)methyl](ethyl)methylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[(4-bromo-3-methylphenyl)methyl]-N-methylethanamine (CAS 1864672-05-8) is a chemical compound with the molecular formula C11H16BrN and a molecular weight of 242.16 g/mol. IUPAC name: N-[(4-bromo-3-methylphenyl)methyl]-N-methylethanamine. InChIKey: ORDIFUFTGIRGCU-UHFFFAOYSA-N.
| Molecular formula | C11H16BrN |
|---|---|
| Molecular weight | 242.16 g/mol |
| IUPAC name | N-[(4-bromo-3-methylphenyl)methyl]-N-methylethanamine |
| InChIKey | ORDIFUFTGIRGCU-UHFFFAOYSA-N |
| SMILES | CCN(C)CC1=CC(=C(C=C1)Br)C |
Computed by PubChem (NCBI)