CAS 1213423-61-0 is the registry number for Methyl (s)-2-amino-3-(2,2-difluorobenzo[d][1,3]dioxol-4-yl)propanoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate (CAS 1213423-61-0) is a chemical compound with the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. IUPAC name: methyl (2S)-2-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate. InChIKey: BXDLHWZRVWDVIC-ZETCQYMHSA-N.
| Molecular formula | C11H11F2NO4 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanoate |
| InChIKey | BXDLHWZRVWDVIC-ZETCQYMHSA-N |
| SMILES | COC(=O)[C@H](CC1=C2C(=CC=C1)OC(O2)(F)F)N |
Computed by PubChem (NCBI)