Products 1503160-11-9
CAS 1503160-11-9 is the registry number for Ethyl 2-(4-carbamoylphenoxy)-2,2-difluoroacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2-(4-carbamoylphenoxy)-2,2-difluoroacetate (CAS 1503160-11-9) is a chemical compound with the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. IUPAC name: ethyl 2-(4-carbamoylphenoxy)-2,2-difluoroacetate. InChIKey: UCRCUDLHADSURO-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO4 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | ethyl 2-(4-carbamoylphenoxy)-2,2-difluoroacetate |
| InChIKey | UCRCUDLHADSURO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(OC1=CC=C(C=C1)C(=O)N)(F)F |
Computed by PubChem (NCBI)