CAS 2641113-93-9 is the registry number for tert-Butyl 2,3-difluoro-4-nitrobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2,3-difluoro-4-nitrobenzoate (CAS 2641113-93-9) is a chemical compound with the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. IUPAC name: tert-butyl 2,3-difluoro-4-nitrobenzoate. InChIKey: KRVPFKDTQWAQCJ-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO4 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | tert-butyl 2,3-difluoro-4-nitrobenzoate |
| InChIKey | KRVPFKDTQWAQCJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=C(C=C1)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)