Products 1508810-78-3

CAS 1508810-78-3 is the registry number for tert-Butyl 2,4-difluoro-5-nitrobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 2,4-difluoro-5-nitrobenzoate (CAS 1508810-78-3) is a chemical compound with the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. IUPAC name: tert-butyl 2,4-difluoro-5-nitrobenzoate. InChIKey: FRLKRANIAWVTGP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11F2NO4
Molecular weight259.21 g/mol
IUPAC nametert-butyl 2,4-difluoro-5-nitrobenzoate
InChIKeyFRLKRANIAWVTGP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=CC(=C(C=C1F)F)[N+](=O)[O-]

Computed by PubChem (NCBI)