CAS 1213466-46-6 is the registry number for (S)-1-(2,4,5-Trimethylphenyl)pentan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(2,4,5-trimethylphenyl)pentan-1-amine (CAS 1213466-46-6) is a chemical compound with the molecular formula C14H23N and a molecular weight of 205.34 g/mol. IUPAC name: (1S)-1-(2,4,5-trimethylphenyl)pentan-1-amine. InChIKey: IHVYXRCNPZVKPQ-AWEZNQCLSA-N.
| Molecular formula | C14H23N |
|---|---|
| Molecular weight | 205.34 g/mol |
| IUPAC name | (1S)-1-(2,4,5-trimethylphenyl)pentan-1-amine |
| InChIKey | IHVYXRCNPZVKPQ-AWEZNQCLSA-N |
| SMILES | CCCC[C@@H](C1=C(C=C(C(=C1)C)C)C)N |
Computed by PubChem (NCBI)