CAS 21860-03-7 appears in our catalog under these names: 2,5-Di-tert-butylaniline, 95%, 2,5–Di–tert–butylaniline, 2,5-DI-TERT-BUTYLANILINE, 99%, 2,5-Di-tert-butylaniline, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 1g, 5g, 250mg, 10G, 100mg.
2,5-ditert-butylaniline (CAS 21860-03-7) is a chemical compound with the molecular formula C14H23N and a molecular weight of 205.34 g/mol. IUPAC name: 2,5-ditert-butylaniline. InChIKey: NUZVLYNISQOZOW-UHFFFAOYSA-N.
| Molecular formula | C14H23N |
|---|---|
| Molecular weight | 205.34 g/mol |
| IUPAC name | 2,5-ditert-butylaniline |
| InChIKey | NUZVLYNISQOZOW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)C(C)(C)C)N |
Computed by PubChem (NCBI)