CAS 2909-77-5 appears in our catalog under these names: 2,6-Diisopropyl-n,n-dimethylaniline, 95%, 2,6-Diisopropyl-N,N-dimethylaniline, 96% , 2,6-DIIsopropyl-N,N-Dimethylaniline, 97%, 97%, 2,6-Diisopropyl-N,N-dimethylaniline, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 10g, 25g, 100g.
N,N-dimethyl-2,6-di(propan-2-yl)aniline (CAS 2909-77-5) is a chemical compound with the molecular formula C14H23N and a molecular weight of 205.34 g/mol. IUPAC name: N,N-dimethyl-2,6-di(propan-2-yl)aniline. InChIKey: ALXIOUGHHXXLKX-UHFFFAOYSA-N.
| Molecular formula | C14H23N |
|---|---|
| Molecular weight | 205.34 g/mol |
| IUPAC name | N,N-dimethyl-2,6-di(propan-2-yl)aniline |
| InChIKey | ALXIOUGHHXXLKX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N(C)C |
Computed by PubChem (NCBI)