CAS 1269437-72-0 appears in our catalog under these names: (S)–1–(2,6–Dimethylphenyl)ethanamine hydrochloride, (S)-1-(2,6-Dimethylphenyl)ethanamine hydrochloride, 97%, 97%, (S)-1-(2,6-dimethylphenyl)ethanamine hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(2,6-dimethylphenyl)ethanamine;hydrochloride (CAS 1269437-72-0) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1S)-1-(2,6-dimethylphenyl)ethanamine;hydrochloride. InChIKey: JQVDNTMMKLGBLJ-FVGYRXGTSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1S)-1-(2,6-dimethylphenyl)ethanamine;hydrochloride |
| InChIKey | JQVDNTMMKLGBLJ-FVGYRXGTSA-N |
| SMILES | CC1=C(C(=CC=C1)C)[C@H](C)N.Cl |
Computed by PubChem (NCBI)