Products 1213502-86-3
CAS 1213502-86-3 is the registry number for (R)-2-(5-Fluoro-2-nitrophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(5-fluoro-2-nitrophenyl)pyrrolidine (CAS 1213502-86-3) is a chemical compound with the molecular formula C10H11FN2O2 and a molecular weight of 210.20 g/mol. IUPAC name: (2R)-2-(5-fluoro-2-nitrophenyl)pyrrolidine. InChIKey: IGAIUYFQILMFGD-SECBINFHSA-N.
| Molecular formula | C10H11FN2O2 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | (2R)-2-(5-fluoro-2-nitrophenyl)pyrrolidine |
| InChIKey | IGAIUYFQILMFGD-SECBINFHSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C=CC(=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)