CAS 1213622-08-2 is the registry number for Methyl (S)-2-amino-2-(3,4-dimethylphenyl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-2-(3,4-dimethylphenyl)acetate (CAS 1213622-08-2) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: methyl (2S)-2-amino-2-(3,4-dimethylphenyl)acetate. InChIKey: GEPOPBIIYKSUQL-JTQLQIEISA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(3,4-dimethylphenyl)acetate |
| InChIKey | GEPOPBIIYKSUQL-JTQLQIEISA-N |
| SMILES | CC1=C(C=C(C=C1)[C@@H](C(=O)OC)N)C |
Computed by PubChem (NCBI)