Products 1213826-92-6
CAS 1213826-92-6 appears in our catalog under these names: 3,5-Dihydroxy-4-isopropylbenzoic acid, 95%, 3,5-Dihydroxy-4-isopropylbenzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
3,5-dihydroxy-4-propan-2-ylbenzoic acid (CAS 1213826-92-6) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 3,5-dihydroxy-4-propan-2-ylbenzoic acid. InChIKey: XIIWDEPRIAPYOR-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3,5-dihydroxy-4-propan-2-ylbenzoic acid |
| InChIKey | XIIWDEPRIAPYOR-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1O)C(=O)O)O |
Computed by PubChem (NCBI)