CAS 1213879-14-1 is the registry number for (R)-2-Amino-2-(2,3,4-trifluorophenyl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-2-(2,3,4-trifluorophenyl)ethanol (CAS 1213879-14-1) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: (2R)-2-amino-2-(2,3,4-trifluorophenyl)ethanol. InChIKey: ZOEZMOHRAWHLAH-LURJTMIESA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | (2R)-2-amino-2-(2,3,4-trifluorophenyl)ethanol |
| InChIKey | ZOEZMOHRAWHLAH-LURJTMIESA-N |
| SMILES | C1=CC(=C(C(=C1[C@H](CO)N)F)F)F |
Computed by PubChem (NCBI)