Products 1213906-91-2
CAS 1213906-91-2 is the registry number for (R)-1-(3-Chloro-4-fluorophenyl)-2,2,2-trifluoroethanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-chloro-4-fluorophenyl)-2,2,2-trifluoroethanamine (CAS 1213906-91-2) is a chemical compound with the molecular formula C8H6ClF4N and a molecular weight of 227.58 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)-2,2,2-trifluoroethanamine. InChIKey: BPSJTWPQNNWBOR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF4N |
|---|---|
| Molecular weight | 227.58 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | BPSJTWPQNNWBOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(F)(F)F)N)Cl)F |
Computed by PubChem (NCBI)