CAS 886370-61-2 appears in our catalog under these names: 1-(3-Chloro-5-fluoro-phenyl)-2,2,2-trifluoro-ethylamine, 95%, 1-(3-Chloro-5-fluorophenyl)-2,2,2-trifluoroethanamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-(3-chloro-5-fluorophenyl)-2,2,2-trifluoroethanamine (CAS 886370-61-2) is a chemical compound with the molecular formula C8H6ClF4N and a molecular weight of 227.58 g/mol. IUPAC name: 1-(3-chloro-5-fluorophenyl)-2,2,2-trifluoroethanamine. InChIKey: NNVGSEBZNLFMOX-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF4N |
|---|---|
| Molecular weight | 227.58 g/mol |
| IUPAC name | 1-(3-chloro-5-fluorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | NNVGSEBZNLFMOX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)Cl)C(C(F)(F)F)N |
Computed by PubChem (NCBI)