CAS 2883712-96-5 is the registry number for 3-Chloro-2-fluoro-4-(2,2,2-trifluoroethyl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-2-fluoro-4-(2,2,2-trifluoroethyl)aniline (CAS 2883712-96-5) is a chemical compound with the molecular formula C8H6ClF4N and a molecular weight of 227.58 g/mol. IUPAC name: 3-chloro-2-fluoro-4-(2,2,2-trifluoroethyl)aniline. InChIKey: SGHLROFWYOLMGS-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF4N |
|---|---|
| Molecular weight | 227.58 g/mol |
| IUPAC name | 3-chloro-2-fluoro-4-(2,2,2-trifluoroethyl)aniline |
| InChIKey | SGHLROFWYOLMGS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC(F)(F)F)Cl)F)N |
Computed by PubChem (NCBI)