CAS 1213908-11-2 appears in our catalog under these names: (S)–1–(4–Chloro–2–methylphenyl)ethanamine, (S)-1-(4-Chloro-2-methylphenyl)ethanamine, 97%, (S)-1-(4-Chloro-2-methylphenyl)ethanamine hydrochloride, 95%, (S)-1-(4-Chloro-2-methylphenyl)ethanamine hydrochloride, 98%. Offered by: GLPBio, AmBeed, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1S)-1-(4-chloro-2-methylphenyl)ethanamine;hydrochloride (CAS 1213908-11-2) is a chemical compound with the molecular formula C9H13Cl2N and a molecular weight of 206.11 g/mol. IUPAC name: (1S)-1-(4-chloro-2-methylphenyl)ethanamine;hydrochloride. InChIKey: FAAKQSKVORTCAV-FJXQXJEOSA-N.
| Molecular formula | C9H13Cl2N |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | (1S)-1-(4-chloro-2-methylphenyl)ethanamine;hydrochloride |
| InChIKey | FAAKQSKVORTCAV-FJXQXJEOSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)[C@H](C)N.Cl |
Computed by PubChem (NCBI)