CAS 251651-29-3 is the registry number for 2,6-Dimethyl-3,5-bis(trifluoromethyl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,6-dimethyl-3,5-bis(trifluoromethyl)aniline (CAS 251651-29-3) is a chemical compound with the molecular formula C10H9F6N and a molecular weight of 257.18 g/mol. IUPAC name: 2,6-dimethyl-3,5-bis(trifluoromethyl)aniline. InChIKey: XHIYKMJTKFYZML-UHFFFAOYSA-N.
| Molecular formula | C10H9F6N |
|---|---|
| Molecular weight | 257.18 g/mol |
| IUPAC name | 2,6-dimethyl-3,5-bis(trifluoromethyl)aniline |
| InChIKey | XHIYKMJTKFYZML-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1C(F)(F)F)C(F)(F)F)C)N |
Computed by PubChem (NCBI)