Products 1213946-30-5
CAS 1213946-30-5 is the registry number for (S)-1-(4-Bromo-2-chlorophenyl)ethan-1-amine, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
(1S)-1-(4-bromo-2-chlorophenyl)ethanamine (CAS 1213946-30-5) is a chemical compound with the molecular formula C8H9BrClN and a molecular weight of 234.52 g/mol. IUPAC name: (1S)-1-(4-bromo-2-chlorophenyl)ethanamine. InChIKey: HIVILXRPZVDOLD-YFKPBYRVSA-N.
| Molecular formula | C8H9BrClN |
|---|---|
| Molecular weight | 234.52 g/mol |
| IUPAC name | (1S)-1-(4-bromo-2-chlorophenyl)ethanamine |
| InChIKey | HIVILXRPZVDOLD-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)Br)Cl)N |
Computed by PubChem (NCBI)