Products 1214028-80-4

CAS 1214028-80-4 appears in our catalog under these names: 2-(2-Methyl-1h-imidazol-1-yl)propanoic acid hydrochloride, 95%, 2-(2-Methyl-1H-imidazol-1-yl)propanoic acid hydrochloride, 97%, 2-(2-Methyl-1H-imidazol-1-yl)propanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g.

Structural formula: {0} (CAS {1})

2-(2-methylimidazol-1-yl)propanoic acid;hydrochloride (CAS 1214028-80-4) is a chemical compound with the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. IUPAC name: 2-(2-methylimidazol-1-yl)propanoic acid;hydrochloride. InChIKey: PDNOFZDEPHCDNS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClN2O2
Molecular weight190.63 g/mol
IUPAC name2-(2-methylimidazol-1-yl)propanoic acid;hydrochloride
InChIKeyPDNOFZDEPHCDNS-UHFFFAOYSA-N
SMILESCC1=NC=CN1C(C)C(=O)O.Cl

Computed by PubChem (NCBI)