Products 1214064-58-0

CAS 1214064-58-0 is the registry number for 3-Isopropyl-1-methyl-2-piperazinone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-methyl-3-propan-2-ylpiperazin-2-one;hydrochloride (CAS 1214064-58-0) is a chemical compound with the molecular formula C8H17ClN2O and a molecular weight of 192.68 g/mol. IUPAC name: 1-methyl-3-propan-2-ylpiperazin-2-one;hydrochloride. InChIKey: AKDVBOQVEPFILV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClN2O
Molecular weight192.68 g/mol
IUPAC name1-methyl-3-propan-2-ylpiperazin-2-one;hydrochloride
InChIKeyAKDVBOQVEPFILV-UHFFFAOYSA-N
SMILESCC(C)C1C(=O)N(CCN1)C.Cl

Computed by PubChem (NCBI)