Products 1262774-69-5

CAS 1262774-69-5 is the registry number for 5-[(Isopropylamino)methyl]-2-pyrrolidinone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-[(propan-2-ylamino)methyl]pyrrolidin-2-one;hydrochloride (CAS 1262774-69-5) is a chemical compound with the molecular formula C8H17ClN2O and a molecular weight of 192.68 g/mol. IUPAC name: 5-[(propan-2-ylamino)methyl]pyrrolidin-2-one;hydrochloride. InChIKey: UZLLPQJPBDVCCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClN2O
Molecular weight192.68 g/mol
IUPAC name5-[(propan-2-ylamino)methyl]pyrrolidin-2-one;hydrochloride
InChIKeyUZLLPQJPBDVCCQ-UHFFFAOYSA-N
SMILESCC(C)NCC1CCC(=O)N1.Cl

Computed by PubChem (NCBI)