Products 6270-42-4

CAS 6270-42-4 appears in our catalog under these names: Piperidine-4-carboxylic acid dimethylamide HCl, N,N-Dimethylpiperidine-4-carboxamide hydrochloride, 96%, N,N-Dimethylpiperidine-4-carboxamide hydrochloride, 97%, N,N-Dimethylpiperidine-4-carboxamide hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 2,5g, 1g, 250mg, 5g, 10g, 100mg, 500mg.

Structural formula: {0} (CAS {1})

N,N-dimethylpiperidine-4-carboxamide;hydrochloride (CAS 6270-42-4) is a chemical compound with the molecular formula C8H17ClN2O and a molecular weight of 192.68 g/mol. IUPAC name: N,N-dimethylpiperidine-4-carboxamide;hydrochloride. InChIKey: AQEDPORECJZBIA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClN2O
Molecular weight192.68 g/mol
IUPAC nameN,N-dimethylpiperidine-4-carboxamide;hydrochloride
InChIKeyAQEDPORECJZBIA-UHFFFAOYSA-N
SMILESCN(C)C(=O)C1CCNCC1.Cl

Computed by PubChem (NCBI)