CAS 1214108-42-5 appears in our catalog under these names: 2-(2,6-Dimethylmorpholin-4-yl)-3-methylbutanoic acid hydrochloride, 95%, 2-(2,6-Dimethylmorpholin-4-yl)-3-methylbutanoic acid hydrochloride, 98%, 2-(2,6-Dimethylmorpholin-4-yl)-3-methylbutanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-(2,6-dimethylmorpholin-4-yl)-3-methylbutanoic acid;hydrochloride (CAS 1214108-42-5) is a chemical compound with the molecular formula C11H22ClNO3 and a molecular weight of 251.75 g/mol. IUPAC name: 2-(2,6-dimethylmorpholin-4-yl)-3-methylbutanoic acid;hydrochloride. InChIKey: CEWMNYAOZNZJFR-UHFFFAOYSA-N.
| Molecular formula | C11H22ClNO3 |
|---|---|
| Molecular weight | 251.75 g/mol |
| IUPAC name | 2-(2,6-dimethylmorpholin-4-yl)-3-methylbutanoic acid;hydrochloride |
| InChIKey | CEWMNYAOZNZJFR-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C(C(C)C)C(=O)O.Cl |
Computed by PubChem (NCBI)