CAS 2174007-86-2 is the registry number for Methyl 4-amino-2,2,6,6-tetramethyloxane-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 4-amino-2,2,6,6-tetramethyloxane-4-carboxylate;hydrochloride (CAS 2174007-86-2) is a chemical compound with the molecular formula C11H22ClNO3 and a molecular weight of 251.75 g/mol. IUPAC name: methyl 4-amino-2,2,6,6-tetramethyloxane-4-carboxylate;hydrochloride. InChIKey: SDMGIFNMFMICTG-UHFFFAOYSA-N.
| Molecular formula | C11H22ClNO3 |
|---|---|
| Molecular weight | 251.75 g/mol |
| IUPAC name | methyl 4-amino-2,2,6,6-tetramethyloxane-4-carboxylate;hydrochloride |
| InChIKey | SDMGIFNMFMICTG-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(O1)(C)C)(C(=O)OC)N)C.Cl |
Computed by PubChem (NCBI)