CAS 2387791-62-8 is the registry number for Ethyl (2R,3R)-3-methoxy-2-methyl-3-((S)-pyrrolidin-2-yl)propanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate;hydrochloride (CAS 2387791-62-8) is a chemical compound with the molecular formula C11H22ClNO3 and a molecular weight of 251.75 g/mol. IUPAC name: ethyl (2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate;hydrochloride. InChIKey: PHDNMEOFYIXGHN-YMQJAAJZSA-N.
| Molecular formula | C11H22ClNO3 |
|---|---|
| Molecular weight | 251.75 g/mol |
| IUPAC name | ethyl (2R,3R)-3-methoxy-2-methyl-3-[(2S)-pyrrolidin-2-yl]propanoate;hydrochloride |
| InChIKey | PHDNMEOFYIXGHN-YMQJAAJZSA-N |
| SMILES | CCOC(=O)[C@H](C)[C@H]([C@@H]1CCCN1)OC.Cl |
Computed by PubChem (NCBI)