CAS 1214267-09-0 appears in our catalog under these names: Laquinimod–d5, Laquinimod-d5, 98.25%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5 mg, 1 mg, 10 mg.
5-chloro-N-ethyl-4-hydroxy-1-methyl-2-oxo-N-(2,3,4,5,6-pentadeuteriophenyl)quinoline-3-carboxamide (CAS 1214267-09-0) is a chemical compound with the molecular formula C19H17ClN2O3 and a molecular weight of 361.8 g/mol. IUPAC name: 5-chloro-N-ethyl-4-hydroxy-1-methyl-2-oxo-N-(2,3,4,5,6-pentadeuteriophenyl)quinoline-3-carboxamide. InChIKey: GKWPCEFFIHSJOE-SPUMIAEJSA-N.
| Molecular formula | C19H17ClN2O3 |
|---|---|
| Molecular weight | 361.8 g/mol |
| IUPAC name | 5-chloro-N-ethyl-4-hydroxy-1-methyl-2-oxo-N-(2,3,4,5,6-pentadeuteriophenyl)quinoline-3-carboxamide |
| InChIKey | GKWPCEFFIHSJOE-SPUMIAEJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N(CC)C(=O)C2=C(C3=C(C=CC=C3Cl)N(C2=O)C)O)[2H])[2H] |
Computed by PubChem (NCBI)