Products 2986319-18-8

CAS 2986319-18-8 is the registry number for S19-1035, 99.93%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 5 mg, 10 mg, 25 mg, 100 mg, 10mM/1mL.

Structural formula: {0} (CAS {1})

N-(2-chlorophenyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide (CAS 2986319-18-8) is a chemical compound with the molecular formula C19H17ClN2O3 and a molecular weight of 356.8 g/mol. IUPAC name: N-(2-chlorophenyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide. InChIKey: DPKPKQOCNMAUHN-UHFFFAOYSA-N.

Identity
Molecular formulaC19H17ClN2O3
Molecular weight356.8 g/mol
IUPAC nameN-(2-chlorophenyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide
InChIKeyDPKPKQOCNMAUHN-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C)COC2=CC=CC=C2C(=O)NC3=CC=CC=C3Cl

Computed by PubChem (NCBI)